C7H11N3O — CID 89319523
[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]urea (PubChem CID 89319523) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is [(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]urea.
| Compound Name | [(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]urea |
|---|---|
| PubChem CID | 89319523 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | [(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]urea |
| SMILES | C=C(/C=C\C=C/N)NC(N)=O |
| InChI | InChI=1S/C7H11N3O/c1-6(10-7(9)11)4-2-3-5-8/h2-5H,1,8H2,(H3,9,10,11)/b4-2-,5-3- |
| InChIKey | NGCINGYCIHXOSK-JVLMNHKTSA-N |
| XLogP | 0.20 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|