piperidine-1-carboximidoyl fluoride

C6H11FN2 — CID 89319756

IUPACpiperidine-1-carboximidoyl fluoride
SMILES[H]/N=C(\F)N1CCCCC1
InChIInChI=1S/C6H11FN2/c7-6(8)9-4-2-1-3-5-9/h8H,1-5H2/b8-6+
InChIKeyGXTSBJMJEPDQEI-SOFGYWHQSA-N
MW130.17 g/mol
LogP1.38
Rot. Bonds

About piperidine-1-carboximidoyl fluoride

piperidine-1-carboximidoyl fluoride (PubChem CID 89319756) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is piperidine-1-carboximidoyl fluoride.

Molecular Properties

Compound Namepiperidine-1-carboximidoyl fluoride
PubChem CID89319756
Molecular FormulaC6H11FN2
Molecular Weight130.17 g/mol
Exact Mass130.09
IUPAC Namepiperidine-1-carboximidoyl fluoride
SMILES[H]/N=C(\F)N1CCCCC1
InChIInChI=1S/C6H11FN2/c7-6(8)9-4-2-1-3-5-9/h8H,1-5H2/b8-6+
InChIKeyGXTSBJMJEPDQEI-SOFGYWHQSA-N
XLogP1.38
TPSA27.09 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.17
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze piperidine-1-carboximidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidine-1-carboximidoyl fluoride?
The IUPAC name of piperidine-1-carboximidoyl fluoride (CID 89319756) is piperidine-1-carboximidoyl fluoride.
What is the SMILES notation for piperidine-1-carboximidoyl fluoride?
The canonical SMILES for piperidine-1-carboximidoyl fluoride is [H]/N=C(\F)N1CCCCC1.
What is the InChIKey of piperidine-1-carboximidoyl fluoride?
The InChIKey is GXTSBJMJEPDQEI-SOFGYWHQSA-N. The full InChI is InChI=1S/C6H11FN2/c7-6(8)9-4-2-1-3-5-9/h8H,1-5H2/b8-6+.
What are the key properties of piperidine-1-carboximidoyl fluoride?
piperidine-1-carboximidoyl fluoride has a molecular weight of 130.17 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carboximidoyl fluoride is sourced from PubChem (CID 89319756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).