C24H27BN6O5S — CID 89319780
CID 89319780 (PubChem CID 89319780) has the molecular formula C24H27BN6O5S and a molecular weight of 522.40 g/mol.
| Compound Name | CID 89319780 |
|---|---|
| PubChem CID | 89319780 |
| Molecular Formula | C24H27BN6O5S |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(cc1Sc1nc3c(N)ncnc3n1CCC1CCN(C(=O)[C@H](C)OC(C)=O)CC1)OCO2 |
| InChI | InChI=1S/C24H27BN6O5S/c1-13(36-14(2)32)23(33)30-6-3-15(4-7-30)5-8-31-22-20(21(26)27-11-28-22)29-24(31)37-19-10-18-17(9-16(19)25)34-12-35-18/h9-11,13,15H,3-8,12H2,1-2H3,(H2,26,27,28)/t13-/m0/s1 |
| InChIKey | UEYYIYFNNHVXFF-ZDUSSCGKSA-N |
| XLogP | 1.66 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|