C11H21N3 — CID 89319837
(1E,3Z)-1-N'-[(2S)-2-aminopentyl]hexa-1,3,5-triene-1,1-diamine (PubChem CID 89319837) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[(2S)-2-aminopentyl]hexa-1,3,5-triene-1,1-diamine.
| Compound Name | (1E,3Z)-1-N'-[(2S)-2-aminopentyl]hexa-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 89319837 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (1E,3Z)-1-N'-[(2S)-2-aminopentyl]hexa-1,3,5-triene-1,1-diamine |
| SMILES | C=C/C=C\C=C(/N)NC[C@@H](N)CCC |
| InChI | InChI=1S/C11H21N3/c1-3-5-6-8-11(13)14-9-10(12)7-4-2/h3,5-6,8,10,14H,1,4,7,9,12-13H2,2H3/b6-5-,11-8+/t10-/m0/s1 |
| InChIKey | POSCCSFIRMWQCK-QOYGWLNVSA-N |
| XLogP | 1.25 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|