C27H27FN10O4 — CID 89319957
ethyl 3-[4-fluoro-3-[2-[4-[(Z)-N-(methylideneamino)-N-phenylcarbamohydrazonoyl]piperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[2,3-c]pyridin-7-yl]-1H-pyrazole-5-carboxylate (PubChem CID 89319957) has the molecular formula C27H27FN10O4 and a molecular weight of 574.58 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-3-[2-[4-[(Z)-N-(methylideneamino)-N-phenylcarbamohydrazonoyl]piperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[2,3-c]pyridin-7-yl]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[4-fluoro-3-[2-[4-[(Z)-N-(methylideneamino)-N-phenylcarbamohydrazonoyl]piperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[2,3-c]pyridin-7-yl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 89319957 |
| Molecular Formula | C27H27FN10O4 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | ethyl 3-[4-fluoro-3-[2-[4-[(Z)-N-(methylideneamino)-N-phenylcarbamohydrazonoyl]piperazin-1-yl]-2-oxoacetyl]-1H-pyrrolo[2,3-c]pyridin-7-yl]-1H-pyrazole-5-carboxylate |
| SMILES | C=NN(/C(=N\N)N1CCN(C(=O)C(=O)c2c[nH]c3c(-c4cc(C(=O)OCC)[nH]n4)ncc(F)c23)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H27FN10O4/c1-3-42-26(41)20-13-19(34-35-20)22-23-21(18(28)15-32-22)17(14-31-23)24(39)25(40)36-9-11-37(12-10-36)27(33-29)38(30-2)16-7-5-4-6-8-16/h4-8,13-15,31H,2-3,9-12,29H2,1H3,(H,34,35)/b33-27- |
| InChIKey | CQBPBZSCKMMSLE-KGGMANCPSA-N |
| XLogP | 1.95 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|