About 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone
1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone (PubChem CID 89319985) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone |
| PubChem CID | 89319985 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone |
| SMILES | C=C1SC(C(C)=O)=C(C)N1CC |
| InChI | InChI=1S/C9H13NOS/c1-5-10-6(2)9(7(3)11)12-8(10)4/h4-5H2,1-3H3 |
| InChIKey | QVMDTDZWMBDNBD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone (CID 89319985) is 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone is C=C1SC(C(C)=O)=C(C)N1CC.
What is the InChIKey of 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone?
The InChIKey is QVMDTDZWMBDNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS/c1-5-10-6(2)9(7(3)11)12-8(10)4/h4-5H2,1-3H3.
What are the key properties of 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone?
1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone has a molecular weight of 183.28 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-4-methyl-2-methylidene-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 89319985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).