About (2Z)-4-methylpenta-2,4-dienehydrazide
(2Z)-4-methylpenta-2,4-dienehydrazide (PubChem CID 89320031) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (2Z)-4-methylpenta-2,4-dienehydrazide.
Molecular Properties
| Compound Name | (2Z)-4-methylpenta-2,4-dienehydrazide |
| PubChem CID | 89320031 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2Z)-4-methylpenta-2,4-dienehydrazide |
| SMILES | C=C(C)/C=C\C(=O)NN |
| InChI | InChI=1S/C6H10N2O/c1-5(2)3-4-6(9)8-7/h3-4H,1,7H2,2H3,(H,8,9)/b4-3- |
| InChIKey | NOYOVPAIHPFZEA-ARJAWSKDSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4-methylpenta-2,4-dienehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4-methylpenta-2,4-dienehydrazide?
The IUPAC name of (2Z)-4-methylpenta-2,4-dienehydrazide (CID 89320031) is (2Z)-4-methylpenta-2,4-dienehydrazide.
What is the SMILES notation for (2Z)-4-methylpenta-2,4-dienehydrazide?
The canonical SMILES for (2Z)-4-methylpenta-2,4-dienehydrazide is C=C(C)/C=C\C(=O)NN.
What is the InChIKey of (2Z)-4-methylpenta-2,4-dienehydrazide?
The InChIKey is NOYOVPAIHPFZEA-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5(2)3-4-6(9)8-7/h3-4H,1,7H2,2H3,(H,8,9)/b4-3-.
What are the key properties of (2Z)-4-methylpenta-2,4-dienehydrazide?
(2Z)-4-methylpenta-2,4-dienehydrazide has a molecular weight of 126.16 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4-methylpenta-2,4-dienehydrazide is sourced from PubChem (CID 89320031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).