About CID 89320038
CID 89320038 (PubChem CID 89320038) has the molecular formula C23H27BN3+
and a molecular weight of 356.30 g/mol.
Molecular Properties
| Compound Name | CID 89320038 |
| PubChem CID | 89320038 |
| Molecular Formula | C23H27BN3+ |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | — |
| SMILES | [B]CCCCCC[n+]1ccc(/C=N/N(C)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H27BN3/c1-26(21-11-5-4-6-12-21)25-19-20-15-18-27(17-10-3-2-9-16-24)23-14-8-7-13-22(20)23/h4-8,11-15,18-19H,2-3,9-10,16-17H2,1H3/q+1 |
| InChIKey | CSFJURZJIIEDGJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89320038 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89320038?
The IUPAC name of CID 89320038 (CID 89320038) is not available.
What is the SMILES notation for CID 89320038?
The canonical SMILES for CID 89320038 is [B]CCCCCC[n+]1ccc(/C=N/N(C)c2ccccc2)c2ccccc21.
What is the InChIKey of CID 89320038?
The InChIKey is CSFJURZJIIEDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27BN3/c1-26(21-11-5-4-6-12-21)25-19-20-15-18-27(17-10-3-2-9-16-24)23-14-8-7-13-22(20)23/h4-8,11-15,18-19H,2-3,9-10,16-17H2,1H3/q+1.
What are the key properties of CID 89320038?
CID 89320038 has a molecular weight of 356.30 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89320038 is sourced from PubChem (CID 89320038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).