C20H28N5O+ — CID 89320086
N-[(E)-1-(1,3-dimethylimidazol-1-ium-2-yl)ethylideneamino]-6-methoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-amine (PubChem CID 89320086) has the molecular formula C20H28N5O+ and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[(E)-1-(1,3-dimethylimidazol-1-ium-2-yl)ethylideneamino]-6-methoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-amine.
| Compound Name | N-[(E)-1-(1,3-dimethylimidazol-1-ium-2-yl)ethylideneamino]-6-methoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-amine |
|---|---|
| PubChem CID | 89320086 |
| Molecular Formula | C20H28N5O+ |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N-[(E)-1-(1,3-dimethylimidazol-1-ium-2-yl)ethylideneamino]-6-methoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-amine |
| SMILES | COc1c(N/N=C(\C)c2n(C)cc[n+]2C)cc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C20H27N5O/c1-14(20-23(2)11-12-24(20)3)21-22-17-13-15-7-5-9-25-10-6-8-16(18(15)25)19(17)26-4/h11-13H,5-10H2,1-4H3/p+1 |
| InChIKey | NBFSXOZYOAIRSC-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 45.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|