About (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine
(E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine (PubChem CID 89320105) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine |
| PubChem CID | 89320105 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine |
| SMILES | C/C=C(\C(C)N)N1CCC(C)[C@H](C)C1 |
| InChI | InChI=1S/C12H24N2/c1-5-12(11(4)13)14-7-6-9(2)10(3)8-14/h5,9-11H,6-8,13H2,1-4H3/b12-5+/t9?,10-,11?/m1/s1 |
| InChIKey | NUIGRQXYUSBXCN-CWICXQOKSA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine?
The IUPAC name of (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine (CID 89320105) is (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine.
What is the SMILES notation for (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine?
The canonical SMILES for (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine is C/C=C(\C(C)N)N1CCC(C)[C@H](C)C1.
What is the InChIKey of (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine?
The InChIKey is NUIGRQXYUSBXCN-CWICXQOKSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-12(11(4)13)14-7-6-9(2)10(3)8-14/h5,9-11H,6-8,13H2,1-4H3/b12-5+/t9?,10-,11?/m1/s1.
What are the key properties of (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine?
(E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine has a molecular weight of 196.34 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[(3S)-3,4-dimethylpiperidin-1-yl]pent-3-en-2-amine is sourced from PubChem (CID 89320105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).