About N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide
N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide (PubChem CID 89320477) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
| PubChem CID | 89320477 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(=O)C(N)=C(C)C1=O |
| InChI | InChI=1S/C9H10N2O3/c1-4-8(10)7(13)3-6(9(4)14)11-5(2)12/h3H,10H2,1-2H3,(H,11,12) |
| InChIKey | BGPXPNWTPXRRBN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The IUPAC name of N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide (CID 89320477) is N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The canonical SMILES for N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide is CC(=O)NC1=CC(=O)C(N)=C(C)C1=O.
What is the InChIKey of N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The InChIKey is BGPXPNWTPXRRBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-4-8(10)7(13)3-6(9(4)14)11-5(2)12/h3H,10H2,1-2H3,(H,11,12).
What are the key properties of N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide has a molecular weight of 194.19 g/mol, XLogP of -0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide is sourced from PubChem (CID 89320477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).