C35H37F5O6S — CID 89320530
[4-[(E)-3-butoxy-3-oxoprop-1-enyl]phenyl] 3-[4-(3,6-difluorocyclohexa-2,4-dien-1-yl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate (PubChem CID 89320530) has the molecular formula C35H37F5O6S and a molecular weight of 680.73 g/mol. Its IUPAC name is [4-[(E)-3-butoxy-3-oxoprop-1-enyl]phenyl] 3-[4-(3,6-difluorocyclohexa-2,4-dien-1-yl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate.
| Compound Name | [4-[(E)-3-butoxy-3-oxoprop-1-enyl]phenyl] 3-[4-(3,6-difluorocyclohexa-2,4-dien-1-yl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate |
|---|---|
| PubChem CID | 89320530 |
| Molecular Formula | C35H37F5O6S |
| Molecular Weight | 680.73 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | [4-[(E)-3-butoxy-3-oxoprop-1-enyl]phenyl] 3-[4-(3,6-difluorocyclohexa-2,4-dien-1-yl)-4-[4-(trifluoromethyl)phenyl]sulfonylcyclohexyl]propanoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(OC(=O)CCC2CCC(C3C=C(F)C=CC3F)(S(=O)(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H37F5O6S/c1-2-3-22-45-32(41)16-6-24-4-11-28(12-5-24)46-33(42)17-7-25-18-20-34(21-19-25,30-23-27(36)10-15-31(30)37)47(43,44)29-13-8-26(9-14-29)35(38,39)40/h4-6,8-16,23,25,30-31H,2-3,7,17-22H2,1H3/b16-6+ |
| InChIKey | QBERWAGHKGRBIB-OMCISZLKSA-N |
| XLogP | 8.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|