C13H22N2 — CID 89320699
1-[(2R,3Z)-5-[(1S)-cyclohex-2-en-1-yl]hexa-3,5-dien-2-yl]-1-methylhydrazine (PubChem CID 89320699) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(2R,3Z)-5-[(1S)-cyclohex-2-en-1-yl]hexa-3,5-dien-2-yl]-1-methylhydrazine.
| Compound Name | 1-[(2R,3Z)-5-[(1S)-cyclohex-2-en-1-yl]hexa-3,5-dien-2-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 89320699 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[(2R,3Z)-5-[(1S)-cyclohex-2-en-1-yl]hexa-3,5-dien-2-yl]-1-methylhydrazine |
| SMILES | C=C(/C=C\[C@@H](C)N(C)N)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C13H22N2/c1-11(9-10-12(2)15(3)14)13-7-5-4-6-8-13/h5,7,9-10,12-13H,1,4,6,8,14H2,2-3H3/b10-9-/t12-,13-/m1/s1 |
| InChIKey | ZAKAVHOABNZFDN-CYZFJHGLSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|