C15H19BrO — CID 89320713
(3Z,5E,6E,8Z)-8-(1-bromoethenoxy)-5-ethylidene-2-methyldeca-1,3,6,8-tetraene (PubChem CID 89320713) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is (3Z,5E,6E,8Z)-8-(1-bromoethenoxy)-5-ethylidene-2-methyldeca-1,3,6,8-tetraene.
| Compound Name | (3Z,5E,6E,8Z)-8-(1-bromoethenoxy)-5-ethylidene-2-methyldeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 89320713 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (3Z,5E,6E,8Z)-8-(1-bromoethenoxy)-5-ethylidene-2-methyldeca-1,3,6,8-tetraene |
| SMILES | C=C(C)/C=C\C(\C=C\C(=C\C)OC(=C)Br)=C/C |
| InChI | InChI=1S/C15H19BrO/c1-6-14(9-8-12(3)4)10-11-15(7-2)17-13(5)16/h6-11H,3,5H2,1-2,4H3/b9-8-,11-10+,14-6+,15-7- |
| InChIKey | MPTCZVSYZWZEKJ-IDAOEBHVSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|