C15H14F7N3OS — CID 89320754
N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N,N-diethyl-2,2,2-trifluoroethanimidamide (PubChem CID 89320754) has the molecular formula C15H14F7N3OS and a molecular weight of 417.35 g/mol. Its IUPAC name is N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N,N-diethyl-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N,N-diethyl-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 89320754 |
| Molecular Formula | C15H14F7N3OS |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N,N-diethyl-2,2,2-trifluoroethanimidamide |
| SMILES | CCN(CC)/C(=N\c1cc(S(=O)CC(F)(F)F)c(C#N)cc1F)C(F)(F)F |
| InChI | InChI=1S/C15H14F7N3OS/c1-3-25(4-2)13(15(20,21)22)24-11-6-12(9(7-23)5-10(11)16)27(26)8-14(17,18)19/h5-6H,3-4,8H2,1-2H3/b24-13- |
| InChIKey | AXLUXSIGBXQJFW-CFRMEGHHSA-N |
| XLogP | 4.30 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|