C28H31N2O9P — CID 89320778
[6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl bis(prop-2-enyl) phosphate (PubChem CID 89320778) has the molecular formula C28H31N2O9P and a molecular weight of 570.54 g/mol. Its IUPAC name is [6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl bis(prop-2-enyl) phosphate.
| Compound Name | [6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl bis(prop-2-enyl) phosphate |
|---|---|
| PubChem CID | 89320778 |
| Molecular Formula | C28H31N2O9P |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl bis(prop-2-enyl) phosphate |
| SMILES | C=CCOP(=O)(OCC=C)OCn1nc(C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccc(OC)c(C#CC)c21 |
| InChI | InChI=1S/C28H31N2O9P/c1-8-11-20-22(33-4)13-12-21-25(27(31)19-16-23(34-5)28(36-7)24(17-19)35-6)29-30(26(20)21)18-39-40(32,37-14-9-2)38-15-10-3/h9-10,12-13,16-17H,2-3,14-15,18H2,1,4-7H3 |
| InChIKey | QYMPTLINTHFJEL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 116.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|