C16H23NS — CID 89320796
(3E,5Z)-5-[2-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)ethyl]hepta-1,3,5-trien-3-amine (PubChem CID 89320796) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is (3E,5Z)-5-[2-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)ethyl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-5-[2-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)ethyl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89320796 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (3E,5Z)-5-[2-(6-methylsulfanylcyclohexa-1,5-dien-1-yl)ethyl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C(=C/C)CCC1=CCCC=C1SC |
| InChI | InChI=1S/C16H23NS/c1-4-13(12-15(17)5-2)10-11-14-8-6-7-9-16(14)18-3/h4-5,8-9,12H,2,6-7,10-11,17H2,1,3H3/b13-4-,15-12+ |
| InChIKey | ZZPYMDXKCOJBJX-YGEYGYLASA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|