About 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine
4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine (PubChem CID 89320942) has the molecular formula C4H10Cl2N4
and a molecular weight of 185.06 g/mol. Its IUPAC name is 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine.
Molecular Properties
| Compound Name | 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine |
| PubChem CID | 89320942 |
| Molecular Formula | C4H10Cl2N4 |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine |
| SMILES | CNC1NC(Cl)NC(Cl)N1 |
| InChI | InChI=1S/C4H10Cl2N4/c1-7-4-9-2(5)8-3(6)10-4/h2-4,7-10H,1H3 |
| InChIKey | QVJZHCZHZVFMCA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine?
The IUPAC name of 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine (CID 89320942) is 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine.
What is the SMILES notation for 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine?
The canonical SMILES for 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine is CNC1NC(Cl)NC(Cl)N1.
What is the InChIKey of 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine?
The InChIKey is QVJZHCZHZVFMCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10Cl2N4/c1-7-4-9-2(5)8-3(6)10-4/h2-4,7-10H,1H3.
What are the key properties of 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine?
4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine has a molecular weight of 185.06 g/mol, XLogP of -0.68, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-N-methyl-1,3,5-triazinan-2-amine is sourced from PubChem (CID 89320942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).