C11H18O — CID 89321352
(2S,3E,4Z)-5-methyl-3-propylidenehepta-4,6-dien-2-ol (PubChem CID 89321352) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2S,3E,4Z)-5-methyl-3-propylidenehepta-4,6-dien-2-ol.
| Compound Name | (2S,3E,4Z)-5-methyl-3-propylidenehepta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 89321352 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2S,3E,4Z)-5-methyl-3-propylidenehepta-4,6-dien-2-ol |
| SMILES | C=C/C(C)=C\C(=C/CC)[C@H](C)O |
| InChI | InChI=1S/C11H18O/c1-5-7-11(10(4)12)8-9(3)6-2/h6-8,10,12H,2,5H2,1,3-4H3/b9-8-,11-7+/t10-/m0/s1 |
| InChIKey | NMQRMBUVKXAIKW-UWQHKYJCSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|