C19H15ClFN2O2S2+ — CID 89321752
2-[5-chloro-2-[2-[(5-fluoro-3H-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetaldehyde (PubChem CID 89321752) has the molecular formula C19H15ClFN2O2S2+ and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[(5-fluoro-3H-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetaldehyde.
| Compound Name | 2-[5-chloro-2-[2-[(5-fluoro-3H-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 89321752 |
| Molecular Formula | C19H15ClFN2O2S2+ |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-[5-chloro-2-[2-[(5-fluoro-3H-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetaldehyde |
| SMILES | CCC(=Cc1sc2cc(Cl)sc2[n+]1CC=O)C=C1Nc2cc(F)ccc2O1 |
| InChI | InChI=1S/C19H14ClFN2O2S2/c1-2-11(7-17-22-13-9-12(21)3-4-14(13)25-17)8-18-23(5-6-24)19-15(26-18)10-16(20)27-19/h3-4,6-10H,2,5H2,1H3/p+1 |
| InChIKey | JUPIRGWGXUQZHV-UHFFFAOYSA-O |
| XLogP | 5.38 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|