About N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide
N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide (PubChem CID 89321981) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide |
| PubChem CID | 89321981 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide |
| SMILES | C=C(C)C(=C)OCCNC(C)=O |
| InChI | InChI=1S/C9H15NO2/c1-7(2)8(3)12-6-5-10-9(4)11/h1,3,5-6H2,2,4H3,(H,10,11) |
| InChIKey | LVGUGAOQJCVRSS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide?
The IUPAC name of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide (CID 89321981) is N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide.
What is the SMILES notation for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide?
The canonical SMILES for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide is C=C(C)C(=C)OCCNC(C)=O.
What is the InChIKey of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide?
The InChIKey is LVGUGAOQJCVRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-7(2)8(3)12-6-5-10-9(4)11/h1,3,5-6H2,2,4H3,(H,10,11).
What are the key properties of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide?
N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide has a molecular weight of 169.22 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide is sourced from PubChem (CID 89321981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).