C7H8F4O5S — CID 89322155
3-(cyclopropylmethoxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid (PubChem CID 89322155) has the molecular formula C7H8F4O5S and a molecular weight of 280.20 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid.
| Compound Name | 3-(cyclopropylmethoxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89322155 |
| Molecular Formula | C7H8F4O5S |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
| SMILES | O=C(OCC1CC1)C(F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C7H8F4O5S/c8-6(7(9,10)11,17(13,14)15)5(12)16-3-4-1-2-4/h4H,1-3H2,(H,13,14,15) |
| InChIKey | KRCRBIGAEHUDMG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|