C20H14F6O6S3 — CID 89322252
5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 89322252) has the molecular formula C20H14F6O6S3 and a molecular weight of 560.52 g/mol. Its IUPAC name is 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 89322252 |
| Molecular Formula | C20H14F6O6S3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | FC(F)(F)COc1c(-c2scc3c2OCCO3)sc(-c2scc3c2OCCO3)c1OCC(F)(F)F |
| InChI | InChI=1S/C20H14F6O6S3/c21-19(22,23)7-31-13-14(32-8-20(24,25)26)18(16-12-10(6-34-16)28-2-4-30-12)35-17(13)15-11-9(5-33-15)27-1-3-29-11/h5-6H,1-4,7-8H2 |
| InChIKey | WZUVQNILBDHDGA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |