C20H12FIN4OS — CID 89322297
7-[4-fluoro-3-(iodomethyl)phenyl]-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 89322297) has the molecular formula C20H12FIN4OS and a molecular weight of 502.31 g/mol. Its IUPAC name is 7-[4-fluoro-3-(iodomethyl)phenyl]-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 7-[4-fluoro-3-(iodomethyl)phenyl]-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 89322297 |
| Molecular Formula | C20H12FIN4OS |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 7-[4-fluoro-3-(iodomethyl)phenyl]-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | O=C1Nc2c(-c3ccccc3)sc3ncnc(c23)N1c1ccc(F)c(CI)c1 |
| InChI | InChI=1S/C20H12FIN4OS/c21-14-7-6-13(8-12(14)9-22)26-18-15-16(25-20(26)27)17(11-4-2-1-3-5-11)28-19(15)24-10-23-18/h1-8,10H,9H2,(H,25,27) |
| InChIKey | HJIGRJQLKFFJDZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|