C22H16FIN4O3S — CID 89322298
3-(3,4-dimethoxyphenyl)-7-[4-fluoro-3-(iodomethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 89322298) has the molecular formula C22H16FIN4O3S and a molecular weight of 562.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-[4-fluoro-3-(iodomethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-[4-fluoro-3-(iodomethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 89322298 |
| Molecular Formula | C22H16FIN4O3S |
| Molecular Weight | 562.36 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-[4-fluoro-3-(iodomethyl)phenyl]-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | COc1ccc(-c2sc3ncnc4c3c2NC(=O)N4c2ccc(F)c(CI)c2)cc1OC |
| InChI | InChI=1S/C22H16FIN4O3S/c1-30-15-6-3-11(8-16(15)31-2)19-18-17-20(25-10-26-21(17)32-19)28(22(29)27-18)13-4-5-14(23)12(7-13)9-24/h3-8,10H,9H2,1-2H3,(H,27,29) |
| InChIKey | WUJDSJPVXVYSRN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|