About cyclohex-3-ene-1,2-diimine
cyclohex-3-ene-1,2-diimine (PubChem CID 89322383) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is cyclohex-3-ene-1,2-diimine.
Molecular Properties
| Compound Name | cyclohex-3-ene-1,2-diimine |
| PubChem CID | 89322383 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | cyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=CCC\C1=N/[H] |
| InChI | InChI=1S/C6H8N2/c7-5-3-1-2-4-6(5)8/h1,3,7-8H,2,4H2/b7-5+,8-6+ |
| InChIKey | BDBQINNPQBLKNK-KQQUZDAGSA-N |
| XLogP | 1.38 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-ene-1,2-diimine?
The IUPAC name of cyclohex-3-ene-1,2-diimine (CID 89322383) is cyclohex-3-ene-1,2-diimine.
What is the SMILES notation for cyclohex-3-ene-1,2-diimine?
The canonical SMILES for cyclohex-3-ene-1,2-diimine is [H]/N=C1\C=CCC\C1=N/[H].
What is the InChIKey of cyclohex-3-ene-1,2-diimine?
The InChIKey is BDBQINNPQBLKNK-KQQUZDAGSA-N. The full InChI is InChI=1S/C6H8N2/c7-5-3-1-2-4-6(5)8/h1,3,7-8H,2,4H2/b7-5+,8-6+.
What are the key properties of cyclohex-3-ene-1,2-diimine?
cyclohex-3-ene-1,2-diimine has a molecular weight of 108.14 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-ene-1,2-diimine is sourced from PubChem (CID 89322383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).