About 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine
1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine (PubChem CID 89322385) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine |
| PubChem CID | 89322385 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine |
| SMILES | C=C(C)/C=C(/C)n1nnnc1N |
| InChI | InChI=1S/C7H11N5/c1-5(2)4-6(3)12-7(8)9-10-11-12/h4H,1H2,2-3H3,(H2,8,9,11)/b6-4- |
| InChIKey | UWDUYXQCZMWTJK-XQRVVYSFSA-N |
| XLogP | 0.69 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine?
The IUPAC name of 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine (CID 89322385) is 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine.
What is the SMILES notation for 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine?
The canonical SMILES for 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine is C=C(C)/C=C(/C)n1nnnc1N.
What is the InChIKey of 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine?
The InChIKey is UWDUYXQCZMWTJK-XQRVVYSFSA-N. The full InChI is InChI=1S/C7H11N5/c1-5(2)4-6(3)12-7(8)9-10-11-12/h4H,1H2,2-3H3,(H2,8,9,11)/b6-4-.
What are the key properties of 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine?
1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine has a molecular weight of 165.20 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-4-methylpenta-2,4-dien-2-yl]tetrazol-5-amine is sourced from PubChem (CID 89322385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).