About 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid
3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid (PubChem CID 89322411) has the molecular formula C10H15FN2O6S2
and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid.
Molecular Properties
| Compound Name | 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid |
| PubChem CID | 89322411 |
| Molecular Formula | C10H15FN2O6S2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid |
| SMILES | CC(C)(C)NCc1c(F)cc(S(=O)(=O)O)nc1S(=O)(=O)O |
| InChI | InChI=1S/C10H15FN2O6S2/c1-10(2,3)12-5-6-7(11)4-8(20(14,15)16)13-9(6)21(17,18)19/h4,12H,5H2,1-3H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | YVIDTZZYSKQMAO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid?
The IUPAC name of 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid (CID 89322411) is 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid.
What is the SMILES notation for 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid?
The canonical SMILES for 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid is CC(C)(C)NCc1c(F)cc(S(=O)(=O)O)nc1S(=O)(=O)O.
What is the InChIKey of 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid?
The InChIKey is YVIDTZZYSKQMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O6S2/c1-10(2,3)12-5-6-7(11)4-8(20(14,15)16)13-9(6)21(17,18)19/h4,12H,5H2,1-3H3,(H,14,15,16)(H,17,18,19).
What are the key properties of 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid?
3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid has a molecular weight of 342.37 g/mol, XLogP of 0.60, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(tert-butylamino)methyl]-4-fluoropyridine-2,6-disulfonic acid is sourced from PubChem (CID 89322411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).