About 3-N-methylnaphthalene-2,3-diimine
3-N-methylnaphthalene-2,3-diimine (PubChem CID 89322444) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-N-methylnaphthalene-2,3-diimine.
Molecular Properties
| Compound Name | 3-N-methylnaphthalene-2,3-diimine |
| PubChem CID | 89322444 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3-N-methylnaphthalene-2,3-diimine |
| SMILES | [H]/N=C1\C=c2ccccc2=C\C1=N/C |
| InChI | InChI=1S/C11H10N2/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7,12H,1H3/b12-10+,13-11+ |
| InChIKey | DLILENOYSOYZIU-DCIPZJNNSA-N |
| XLogP | 0.35 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-N-methylnaphthalene-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methylnaphthalene-2,3-diimine?
The IUPAC name of 3-N-methylnaphthalene-2,3-diimine (CID 89322444) is 3-N-methylnaphthalene-2,3-diimine.
What is the SMILES notation for 3-N-methylnaphthalene-2,3-diimine?
The canonical SMILES for 3-N-methylnaphthalene-2,3-diimine is [H]/N=C1\C=c2ccccc2=C\C1=N/C.
What is the InChIKey of 3-N-methylnaphthalene-2,3-diimine?
The InChIKey is DLILENOYSOYZIU-DCIPZJNNSA-N. The full InChI is InChI=1S/C11H10N2/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7,12H,1H3/b12-10+,13-11+.
What are the key properties of 3-N-methylnaphthalene-2,3-diimine?
3-N-methylnaphthalene-2,3-diimine has a molecular weight of 170.21 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methylnaphthalene-2,3-diimine is sourced from PubChem (CID 89322444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).