C20H27N5OS — CID 89322602
N-[(1S)-1-[5-[(1Z,3Z)-1-amino-5-[[(3Z,5Z)-6-amino-4-methylhexa-1,3,5-trien-2-yl]amino]hexa-1,3,5-trienyl]-1,3-thiazol-2-yl]ethyl]acetamide (PubChem CID 89322602) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is N-[(1S)-1-[5-[(1Z,3Z)-1-amino-5-[[(3Z,5Z)-6-amino-4-methylhexa-1,3,5-trien-2-yl]amino]hexa-1,3,5-trienyl]-1,3-thiazol-2-yl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[5-[(1Z,3Z)-1-amino-5-[[(3Z,5Z)-6-amino-4-methylhexa-1,3,5-trien-2-yl]amino]hexa-1,3,5-trienyl]-1,3-thiazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 89322602 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(1S)-1-[5-[(1Z,3Z)-1-amino-5-[[(3Z,5Z)-6-amino-4-methylhexa-1,3,5-trien-2-yl]amino]hexa-1,3,5-trienyl]-1,3-thiazol-2-yl]ethyl]acetamide |
| SMILES | C=C(/C=C\C=C(/N)c1cnc([C@H](C)NC(C)=O)s1)NC(=C)/C=C(C)\C=C/N |
| InChI | InChI=1S/C20H27N5OS/c1-13(9-10-21)11-15(3)24-14(2)7-6-8-18(22)19-12-23-20(27-19)16(4)25-17(5)26/h6-12,16,24H,2-3,21-22H2,1,4-5H3,(H,25,26)/b7-6-,10-9-,13-11-,18-8-/t16-/m0/s1 |
| InChIKey | LFIUHKVZDYLLAM-DVCJNBKASA-N |
| XLogP | 3.23 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|