C28H32IN5O2S — CID 89322728
4-[4-[2-[5-[6-[[4-(iodomethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]ethyl]piperidine-1-carbonyl]cyclohexan-1-one (PubChem CID 89322728) has the molecular formula C28H32IN5O2S and a molecular weight of 629.57 g/mol. Its IUPAC name is 4-[4-[2-[5-[6-[[4-(iodomethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]ethyl]piperidine-1-carbonyl]cyclohexan-1-one.
| Compound Name | 4-[4-[2-[5-[6-[[4-(iodomethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]ethyl]piperidine-1-carbonyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 89322728 |
| Molecular Formula | C28H32IN5O2S |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | 4-[4-[2-[5-[6-[[4-(iodomethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]ethyl]piperidine-1-carbonyl]cyclohexan-1-one |
| SMILES | O=C1CCC(C(=O)N2CCC(CCc3ncc(-c4cccc(Nc5cc(CI)ccn5)n4)s3)CC2)CC1 |
| InChI | InChI=1S/C28H32IN5O2S/c29-17-20-10-13-30-26(16-20)33-25-3-1-2-23(32-25)24-18-31-27(37-24)9-4-19-11-14-34(15-12-19)28(36)21-5-7-22(35)8-6-21/h1-3,10,13,16,18-19,21H,4-9,11-12,14-15,17H2,(H,30,32,33) |
| InChIKey | FHNKPEBBKVPNNJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|