C20H30FN7O — CID 89322887
5-N-[(2-fluoroanilino)methyl]-2-N-(2-morpholin-4-ylethyl)-4-N-propan-2-ylpyrimidine-2,4,5-triamine (PubChem CID 89322887) has the molecular formula C20H30FN7O and a molecular weight of 403.51 g/mol. Its IUPAC name is 5-N-[(2-fluoroanilino)methyl]-2-N-(2-morpholin-4-ylethyl)-4-N-propan-2-ylpyrimidine-2,4,5-triamine.
| Compound Name | 5-N-[(2-fluoroanilino)methyl]-2-N-(2-morpholin-4-ylethyl)-4-N-propan-2-ylpyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 89322887 |
| Molecular Formula | C20H30FN7O |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 5-N-[(2-fluoroanilino)methyl]-2-N-(2-morpholin-4-ylethyl)-4-N-propan-2-ylpyrimidine-2,4,5-triamine |
| SMILES | CC(C)Nc1nc(NCCN2CCOCC2)ncc1NCNc1ccccc1F |
| InChI | InChI=1S/C20H30FN7O/c1-15(2)26-19-18(25-14-24-17-6-4-3-5-16(17)21)13-23-20(27-19)22-7-8-28-9-11-29-12-10-28/h3-6,13,15,24-25H,7-12,14H2,1-2H3,(H2,22,23,26,27) |
| InChIKey | WRSWZJJOWQLQLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|