About ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate
ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 8932289) has the molecular formula C17H23Cl2N3O3
and a molecular weight of 388.30 g/mol. Its IUPAC name is ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate |
| PubChem CID | 8932289 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)NCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O3/c1-2-25-17(24)22-9-7-21(8-10-22)12-16(23)20-6-5-13-3-4-14(18)11-15(13)19/h3-4,11H,2,5-10,12H2,1H3,(H,20,23) |
| InChIKey | ZLZPLQBOPKCILK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate (CID 8932289) is ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(CC(=O)NCCc2ccc(Cl)cc2Cl)CC1.
What is the InChIKey of ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate?
The InChIKey is ZLZPLQBOPKCILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23Cl2N3O3/c1-2-25-17(24)22-9-7-21(8-10-22)12-16(23)20-6-5-13-3-4-14(18)11-15(13)19/h3-4,11H,2,5-10,12H2,1H3,(H,20,23).
What are the key properties of ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate?
ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate has a molecular weight of 388.30 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxylate is sourced from PubChem (CID 8932289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).