C17H28O2 — CID 89323304
2-[[(3E,6Z)-5,5,6,9-tetramethyldeca-3,6,9-trien-3-yl]oxymethyl]oxirane (PubChem CID 89323304) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[[(3E,6Z)-5,5,6,9-tetramethyldeca-3,6,9-trien-3-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(3E,6Z)-5,5,6,9-tetramethyldeca-3,6,9-trien-3-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 89323304 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-[[(3E,6Z)-5,5,6,9-tetramethyldeca-3,6,9-trien-3-yl]oxymethyl]oxirane |
| SMILES | C=C(C)C/C=C(/C)C(C)(C)/C=C(\CC)OCC1CO1 |
| InChI | InChI=1S/C17H28O2/c1-7-15(18-11-16-12-19-16)10-17(5,6)14(4)9-8-13(2)3/h9-10,16H,2,7-8,11-12H2,1,3-6H3/b14-9-,15-10+ |
| InChIKey | SVXPQBLZBGATAH-RRFADNKVSA-N |
| XLogP | 4.63 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|