C18H28O — CID 89323306
7-ethyl-1-[(2E,4E)-3-methoxyhexa-2,4-dien-2-yl]-2,6-dimethylcyclohepta-1,3-diene (PubChem CID 89323306) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 7-ethyl-1-[(2E,4E)-3-methoxyhexa-2,4-dien-2-yl]-2,6-dimethylcyclohepta-1,3-diene.
| Compound Name | 7-ethyl-1-[(2E,4E)-3-methoxyhexa-2,4-dien-2-yl]-2,6-dimethylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 89323306 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 7-ethyl-1-[(2E,4E)-3-methoxyhexa-2,4-dien-2-yl]-2,6-dimethylcyclohepta-1,3-diene |
| SMILES | C/C=C/C(OC)=C(/C)C1=C(C)C=CCC(C)C1CC |
| InChI | InChI=1S/C18H28O/c1-7-10-17(19-6)15(5)18-14(4)12-9-11-13(3)16(18)8-2/h7,9-10,12-13,16H,8,11H2,1-6H3/b10-7+,17-15+ |
| InChIKey | UTGNQUXLPIWUPJ-GUNRCEPCSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|