C14H23N3O — CID 89323553
(3Z,5E)-5-amino-1-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylidenehepta-3,5-dien-1-one (PubChem CID 89323553) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (3Z,5E)-5-amino-1-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylidenehepta-3,5-dien-1-one.
| Compound Name | (3Z,5E)-5-amino-1-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 89323553 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (3Z,5E)-5-amino-1-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
| SMILES | C=C(/C=C\C(N)=C/C)C(=O)N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C14H23N3O/c1-5-12(15)7-6-11(2)14(18)17-9-8-13(10-17)16(3)4/h5-7,13H,2,8-10,15H2,1,3-4H3/b7-6-,12-5+ |
| InChIKey | QGKLCEFXIMDELU-BZNMCICSSA-N |
| XLogP | 1.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|