C16H10Br2Cl2O4S — CID 89323714
[4-(3,4-dichlorophenyl)-5-oxo-2H-furan-2-yl]methyl 2,3-dibromo-2,3-dihydrothiophene-5-carboxylate (PubChem CID 89323714) has the molecular formula C16H10Br2Cl2O4S and a molecular weight of 529.03 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)-5-oxo-2H-furan-2-yl]methyl 2,3-dibromo-2,3-dihydrothiophene-5-carboxylate.
| Compound Name | [4-(3,4-dichlorophenyl)-5-oxo-2H-furan-2-yl]methyl 2,3-dibromo-2,3-dihydrothiophene-5-carboxylate |
|---|---|
| PubChem CID | 89323714 |
| Molecular Formula | C16H10Br2Cl2O4S |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 525.80 |
| IUPAC Name | [4-(3,4-dichlorophenyl)-5-oxo-2H-furan-2-yl]methyl 2,3-dibromo-2,3-dihydrothiophene-5-carboxylate |
| SMILES | O=C(OCC1C=C(c2ccc(Cl)c(Cl)c2)C(=O)O1)C1=CC(Br)C(Br)S1 |
| InChI | InChI=1S/C16H10Br2Cl2O4S/c17-10-5-13(25-14(10)18)16(22)23-6-8-4-9(15(21)24-8)7-1-2-11(19)12(20)3-7/h1-5,8,10,14H,6H2 |
| InChIKey | MEKMPFARZCIQKO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|