C31H42N6O5S — CID 89323762
(2S,4R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-[2-[2-(3,3-dimethylbutanoylamino)-1,3-thiazol-4-yl]-7-methoxy-8-methylquinolin-4-yl]oxypyrrolidine-2-carboxamide (PubChem CID 89323762) has the molecular formula C31H42N6O5S and a molecular weight of 610.78 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-[2-[2-(3,3-dimethylbutanoylamino)-1,3-thiazol-4-yl]-7-methoxy-8-methylquinolin-4-yl]oxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-[2-[2-(3,3-dimethylbutanoylamino)-1,3-thiazol-4-yl]-7-methoxy-8-methylquinolin-4-yl]oxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89323762 |
| Molecular Formula | C31H42N6O5S |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-[2-[2-(3,3-dimethylbutanoylamino)-1,3-thiazol-4-yl]-7-methoxy-8-methylquinolin-4-yl]oxypyrrolidine-2-carboxamide |
| SMILES | COc1ccc2c(O[C@@H]3C[C@@H](C(N)=O)N(C(=O)[C@@H](N)C(C)(C)C)C3)cc(-c3csc(NC(=O)CC(C)(C)C)n3)nc2c1C |
| InChI | InChI=1S/C31H42N6O5S/c1-16-22(41-8)10-9-18-23(42-17-11-21(27(33)39)37(14-17)28(40)26(32)31(5,6)7)12-19(34-25(16)18)20-15-43-29(35-20)36-24(38)13-30(2,3)4/h9-10,12,15,17,21,26H,11,13-14,32H2,1-8H3,(H2,33,39)(H,35,36,38)/t17-,21+,26-/m1/s1 |
| InChIKey | JFMRGWFRFVRACK-FQHLQPMKSA-N |
| XLogP | 4.26 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |