C26H32N8O6 — CID 89323916
(4-aminophenyl) 4-[[6-amino-9-[(2R,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 89323916) has the molecular formula C26H32N8O6 and a molecular weight of 552.59 g/mol. Its IUPAC name is (4-aminophenyl) 4-[[6-amino-9-[(2R,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | (4-aminophenyl) 4-[[6-amino-9-[(2R,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89323916 |
| Molecular Formula | C26H32N8O6 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (4-aminophenyl) 4-[[6-amino-9-[(2R,4R,5S)-5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | Nc1ccc(OC(=O)N2CCC(Cc3nc(N)c4ncn([C@@H]5O[C@H](C(=O)NC6CC6)[C@H](O)C5O)c4n3)CC2)cc1 |
| InChI | InChI=1S/C26H32N8O6/c27-14-1-5-16(6-2-14)39-26(38)33-9-7-13(8-10-33)11-17-31-22(28)18-23(32-17)34(12-29-18)25-20(36)19(35)21(40-25)24(37)30-15-3-4-15/h1-2,5-6,12-13,15,19-21,25,35-36H,3-4,7-11,27H2,(H,30,37)(H2,28,31,32)/t19-,20?,21+,25-/m1/s1 |
| InChIKey | UYEVFYXLWVDRSE-NCXWNNBYSA-N |
| XLogP | 0.34 |
| TPSA | 203.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|