C21H25N3S2+2 — CID 89324018
N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[(3-methyl-1,3-thiazol-3-ium-2-yl)sulfanyl]ethyl]aniline (PubChem CID 89324018) has the molecular formula C21H25N3S2+2 and a molecular weight of 383.59 g/mol. Its IUPAC name is N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[(3-methyl-1,3-thiazol-3-ium-2-yl)sulfanyl]ethyl]aniline.
| Compound Name | N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[(3-methyl-1,3-thiazol-3-ium-2-yl)sulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 89324018 |
| Molecular Formula | C21H25N3S2+2 |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[(3-methyl-1,3-thiazol-3-ium-2-yl)sulfanyl]ethyl]aniline |
| SMILES | CN(CCSc1scc[n+]1C)c1ccc(/C=C/c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C21H25N3S2/c1-22-12-10-19(11-13-22)5-4-18-6-8-20(9-7-18)23(2)14-16-25-21-24(3)15-17-26-21/h4-13,15,17H,14,16H2,1-3H3/q+2 |
| InChIKey | TZBGPNFNJRIGPZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|