About 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea
1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea (PubChem CID 89324346) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea.
Molecular Properties
| Compound Name | 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea |
| PubChem CID | 89324346 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea |
| SMILES | CN(N)C(=O)NCC1=CCCC=C1 |
| InChI | InChI=1S/C9H15N3O/c1-12(10)9(13)11-7-8-5-3-2-4-6-8/h3,5-6H,2,4,7,10H2,1H3,(H,11,13) |
| InChIKey | JDAJLBCMTUDWRE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea?
The IUPAC name of 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea (CID 89324346) is 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea.
What is the SMILES notation for 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea?
The canonical SMILES for 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea is CN(N)C(=O)NCC1=CCCC=C1.
What is the InChIKey of 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea?
The InChIKey is JDAJLBCMTUDWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-12(10)9(13)11-7-8-5-3-2-4-6-8/h3,5-6H,2,4,7,10H2,1H3,(H,11,13).
What are the key properties of 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea?
1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea has a molecular weight of 181.24 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylurea is sourced from PubChem (CID 89324346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).