About 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine
1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine (PubChem CID 89324381) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine |
| PubChem CID | 89324381 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine |
| SMILES | C=C/C(=C\C=C/C)CNNC |
| InChI | InChI=1S/C9H16N2/c1-4-6-7-9(5-2)8-11-10-3/h4-7,10-11H,2,8H2,1,3H3/b6-4-,9-7+ |
| InChIKey | UGVAPYWYTBNBNB-UNQQQNFISA-N |
| XLogP | 1.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine?
The IUPAC name of 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine (CID 89324381) is 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine.
What is the SMILES notation for 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine?
The canonical SMILES for 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine is C=C/C(=C\C=C/C)CNNC.
What is the InChIKey of 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine?
The InChIKey is UGVAPYWYTBNBNB-UNQQQNFISA-N. The full InChI is InChI=1S/C9H16N2/c1-4-6-7-9(5-2)8-11-10-3/h4-7,10-11H,2,8H2,1,3H3/b6-4-,9-7+.
What are the key properties of 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine?
1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine has a molecular weight of 152.24 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-methylhydrazine is sourced from PubChem (CID 89324381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).