About 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde
2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde (PubChem CID 89324384) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde |
| PubChem CID | 89324384 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde |
| SMILES | COC1C=CC(CC=O)=CC1 |
| InChI | InChI=1S/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-4,7,9H,5-6H2,1H3 |
| InChIKey | ACOXRCGDHPOPEY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde (CID 89324384) is 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde is COC1C=CC(CC=O)=CC1.
What is the InChIKey of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde?
The InChIKey is ACOXRCGDHPOPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-4,7,9H,5-6H2,1H3.
What are the key properties of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde?
2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde has a molecular weight of 152.19 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetaldehyde is sourced from PubChem (CID 89324384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).