C34H62O9Si2 — CID 89324399
[(2S,3S,4E)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] 3-methylcyclobutane-1-carboxylate (PubChem CID 89324399) has the molecular formula C34H62O9Si2 and a molecular weight of 671.03 g/mol. Its IUPAC name is [(2S,3S,4E)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] 3-methylcyclobutane-1-carboxylate.
| Compound Name | [(2S,3S,4E)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] 3-methylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 89324399 |
| Molecular Formula | C34H62O9Si2 |
| Molecular Weight | 671.03 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | [(2S,3S,4E)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] 3-methylcyclobutane-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OCC(CC1C/C(=C\C(=O)OC)[C@H](OC(=O)C2CC(C)C2)[C@](OC)(C(C)(C)C=O)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H62O9Si2/c1-12-44(13-2,14-3)40-23-29(43-45(15-4,16-5)17-6)22-28-20-26(21-30(36)38-10)31(41-32(37)27-18-25(7)19-27)34(39-11,42-28)33(8,9)24-35/h21,24-25,27-29,31H,12-20,22-23H2,1-11H3/b26-21+/t25?,27?,28?,29?,31-,34+/m0/s1 |
| InChIKey | AWLDRTJQCOIUET-QQDHJXSFSA-N |
| XLogP | 7.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.03 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|