About (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one
(7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one (PubChem CID 89324420) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one.
Molecular Properties
| Compound Name | (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one |
| PubChem CID | 89324420 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one |
| SMILES | C=CC[C@@H](O)CCCC(=O)C(C)(C)COS |
| InChI | InChI=1S/C12H22O3S/c1-4-6-10(13)7-5-8-11(14)12(2,3)9-15-16/h4,10,13,16H,1,5-9H2,2-3H3/t10-/m1/s1 |
| InChIKey | WNMYNYXVBULRPE-SNVBAGLBSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one?
The IUPAC name of (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one (CID 89324420) is (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one.
What is the SMILES notation for (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one?
The canonical SMILES for (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one is C=CC[C@@H](O)CCCC(=O)C(C)(C)COS.
What is the InChIKey of (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one?
The InChIKey is WNMYNYXVBULRPE-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H22O3S/c1-4-6-10(13)7-5-8-11(14)12(2,3)9-15-16/h4,10,13,16H,1,5-9H2,2-3H3/t10-/m1/s1.
What are the key properties of (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one?
(7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one has a molecular weight of 246.37 g/mol, XLogP of 2.55, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-hydroxy-2,2-dimethyl-1-sulfanyloxydec-9-en-3-one is sourced from PubChem (CID 89324420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).