C40H44O6 — CID 89324442
[2,5-bis(1-ethoxyethoxy)-4-[hydroxy(diphenyl)methyl]phenyl]-cyclohexa-2,4-dien-1-yl-phenylmethanol (PubChem CID 89324442) has the molecular formula C40H44O6 and a molecular weight of 620.79 g/mol. Its IUPAC name is [2,5-bis(1-ethoxyethoxy)-4-[hydroxy(diphenyl)methyl]phenyl]-cyclohexa-2,4-dien-1-yl-phenylmethanol.
| Compound Name | [2,5-bis(1-ethoxyethoxy)-4-[hydroxy(diphenyl)methyl]phenyl]-cyclohexa-2,4-dien-1-yl-phenylmethanol |
|---|---|
| PubChem CID | 89324442 |
| Molecular Formula | C40H44O6 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | [2,5-bis(1-ethoxyethoxy)-4-[hydroxy(diphenyl)methyl]phenyl]-cyclohexa-2,4-dien-1-yl-phenylmethanol |
| SMILES | CCOC(C)Oc1cc(C(O)(c2ccccc2)C2C=CC=CC2)c(OC(C)OCC)cc1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44O6/c1-5-43-29(3)45-37-27-36(40(42,33-23-15-9-16-24-33)34-25-17-10-18-26-34)38(46-30(4)44-6-2)28-35(37)39(41,31-19-11-7-12-20-31)32-21-13-8-14-22-32/h7-25,27-30,34,41-42H,5-6,26H2,1-4H3 |
| InChIKey | FILGEXUDJZJJKC-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|