About (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene
(Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene (PubChem CID 89324738) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene.
Molecular Properties
| Compound Name | (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene |
| PubChem CID | 89324738 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene |
| SMILES | C=C(CC)O/C(=C\C)CC(C)(C)C |
| InChI | InChI=1S/C12H22O/c1-7-10(3)13-11(8-2)9-12(4,5)6/h8H,3,7,9H2,1-2,4-6H3/b11-8- |
| InChIKey | WEVABKBZUPFDMH-FLIBITNWSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene?
The IUPAC name of (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene (CID 89324738) is (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene.
What is the SMILES notation for (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene?
The canonical SMILES for (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene is C=C(CC)O/C(=C\C)CC(C)(C)C.
What is the InChIKey of (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene?
The InChIKey is WEVABKBZUPFDMH-FLIBITNWSA-N. The full InChI is InChI=1S/C12H22O/c1-7-10(3)13-11(8-2)9-12(4,5)6/h8H,3,7,9H2,1-2,4-6H3/b11-8-.
What are the key properties of (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene?
(Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene has a molecular weight of 182.31 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-but-1-en-2-yloxy-5,5-dimethylhex-2-ene is sourced from PubChem (CID 89324738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).