About 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate
4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 89324918) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate |
| PubChem CID | 89324918 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC(C)CCOC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38O3/c1-14(2)13-19(10,17(4,5)6)16(20)22-15(3)11-12-21-18(7,8)9/h14-15H,11-13H2,1-10H3 |
| InChIKey | NSPLINOVKYRFRG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate?
The IUPAC name of 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate (CID 89324918) is 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate.
What is the SMILES notation for 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate?
The canonical SMILES for 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate is CC(C)CC(C)(C(=O)OC(C)CCOC(C)(C)C)C(C)(C)C.
What is the InChIKey of 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate?
The InChIKey is NSPLINOVKYRFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O3/c1-14(2)13-19(10,17(4,5)6)16(20)22-15(3)11-12-21-18(7,8)9/h14-15H,11-13H2,1-10H3.
What are the key properties of 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate?
4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate has a molecular weight of 314.51 g/mol, XLogP of 5.22, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methylpropan-2-yl)oxy]butan-2-yl 2-tert-butyl-2,4-dimethylpentanoate is sourced from PubChem (CID 89324918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).