C9H15N3 — CID 89324957
(2Z,4Z)-1-N-(1-aminoethenyl)hepta-2,4,6-triene-1,2-diamine (PubChem CID 89324957) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (2Z,4Z)-1-N-(1-aminoethenyl)hepta-2,4,6-triene-1,2-diamine.
| Compound Name | (2Z,4Z)-1-N-(1-aminoethenyl)hepta-2,4,6-triene-1,2-diamine |
|---|---|
| PubChem CID | 89324957 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (2Z,4Z)-1-N-(1-aminoethenyl)hepta-2,4,6-triene-1,2-diamine |
| SMILES | C=C/C=C\C=C(/N)CNC(=C)N |
| InChI | InChI=1S/C9H15N3/c1-3-4-5-6-9(11)7-12-8(2)10/h3-6,12H,1-2,7,10-11H2/b5-4-,9-6- |
| InChIKey | OUKSJQPINQRAOY-WXOLFVLTSA-N |
| XLogP | 0.59 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|