C17H30N2 — CID 89324964
(2Z,5E,7E)-7-ethylidene-4-methyl-6-propan-2-ylundeca-2,5,10-triene-1,2-diamine (PubChem CID 89324964) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (2Z,5E,7E)-7-ethylidene-4-methyl-6-propan-2-ylundeca-2,5,10-triene-1,2-diamine.
| Compound Name | (2Z,5E,7E)-7-ethylidene-4-methyl-6-propan-2-ylundeca-2,5,10-triene-1,2-diamine |
|---|---|
| PubChem CID | 89324964 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (2Z,5E,7E)-7-ethylidene-4-methyl-6-propan-2-ylundeca-2,5,10-triene-1,2-diamine |
| SMILES | C=CCCC(=C\C)/C(=C/C(C)/C=C(\N)CN)C(C)C |
| InChI | InChI=1S/C17H30N2/c1-6-8-9-15(7-2)17(13(3)4)11-14(5)10-16(19)12-18/h6-7,10-11,13-14H,1,8-9,12,18-19H2,2-5H3/b15-7+,16-10-,17-11+ |
| InChIKey | BZLIUEDQTPALHC-RDDPGYGLSA-N |
| XLogP | 3.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|